C36H36N6O3S2 — CID 126194015
(6S)-6-tert-butyl-2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126194015) has the molecular formula C36H36N6O3S2 and a molecular weight of 664.86 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126194015 |
| Molecular Formula | C36H36N6O3S2 |
| Molecular Weight | 664.86 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(Sc2ccc([N+](=O)[O-])cc2C=Nc2sc3c(c2C(=O)Nc2ccccc2)CC[C@H](C(C)(C)C)C3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C36H36N6O3S2/c1-5-41-32(23-12-8-6-9-13-23)39-40-35(41)47-29-19-17-27(42(44)45)20-24(29)22-37-34-31(33(43)38-26-14-10-7-11-15-26)28-18-16-25(36(2,3)4)21-30(28)46-34/h6-15,17,19-20,22,25H,5,16,18,21H2,1-4H3,(H,38,43)/t25-/m0/s1 |
| InChIKey | BUYGKMWGNXSDKQ-VWLOTQADSA-N |
| XLogP | 9.24 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.86 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|