C18H17N7O3S — CID 126201909
[(Z)-[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]urea (PubChem CID 126201909) has the molecular formula C18H17N7O3S and a molecular weight of 411.45 g/mol. Its IUPAC name is [(Z)-[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]urea.
| Compound Name | [(Z)-[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 126201909 |
| Molecular Formula | C18H17N7O3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [(Z)-[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]urea |
| SMILES | CCn1c(Sc2ccc([N+](=O)[O-])cc2/C=N\NC(N)=O)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H17N7O3S/c1-2-24-16(12-6-4-3-5-7-12)21-23-18(24)29-15-9-8-14(25(27)28)10-13(15)11-20-22-17(19)26/h3-11H,2H2,1H3,(H3,19,22,26)/b20-11- |
| InChIKey | VCOMXVRKXYWUIG-JAIQZWGSSA-N |
| XLogP | 3.03 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|