C22H18ClN7O4S2 — CID 126196326
(E)-3-[2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 126196326) has the molecular formula C22H18ClN7O4S2 and a molecular weight of 544.02 g/mol. Its IUPAC name is (E)-3-[2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126196326 |
| Molecular Formula | C22H18ClN7O4S2 |
| Molecular Weight | 544.02 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | (E)-3-[2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | CCn1c(Sc2ccc([N+](=O)[O-])cc2/C=C(/Sc2n[nH]c(C)n2)C(=O)O)nnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H18ClN7O4S2/c1-3-29-19(13-5-4-6-15(23)9-13)26-28-22(29)36-17-8-7-16(30(33)34)10-14(17)11-18(20(31)32)35-21-24-12(2)25-27-21/h4-11H,3H2,1-2H3,(H,31,32)(H,24,25,27)/b18-11+ |
| InChIKey | WCNYSMAZCSCELO-WOJGMQOQSA-N |
| XLogP | 5.32 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.02 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|