C28H21N5O4S — CID 126199486
(Z)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid (PubChem CID 126199486) has the molecular formula C28H21N5O4S and a molecular weight of 523.57 g/mol. Its IUPAC name is (Z)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126199486 |
| Molecular Formula | C28H21N5O4S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (Z)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid |
| SMILES | Cc1nc(S/C(=C\c2cc(-c3ccccc3)n(-c3ccc([N+](=O)[O-])cc3)c2-c2ccccc2)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C28H21N5O4S/c1-18-29-28(31-30-18)38-25(27(34)35)17-21-16-24(19-8-4-2-5-9-19)32(26(21)20-10-6-3-7-11-20)22-12-14-23(15-13-22)33(36)37/h2-17H,1H3,(H,34,35)(H,29,30,31)/b25-17- |
| InChIKey | IDMSLRVPQHKYGH-UQQQWYQISA-N |
| XLogP | 6.36 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|