C13H12N4O4S — CID 124662118
(Z)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid (PubChem CID 124662118) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is (Z)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 124662118 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (Z)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid |
| SMILES | CCc1nc(S/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C13H12N4O4S/c1-2-11-14-13(16-15-11)22-10(12(18)19)7-8-3-5-9(6-4-8)17(20)21/h3-7H,2H2,1H3,(H,18,19)(H,14,15,16)/b10-7- |
| InChIKey | ZFACCMUNTVDEKW-YFHOEESVSA-N |
| XLogP | 2.49 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|