C13H11ClN3O3S- — CID 54715499
2-[(Z)-2-carboxy-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-4-chlorophenolate (PubChem CID 54715499) has the molecular formula C13H11ClN3O3S- and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-[(Z)-2-carboxy-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-4-chlorophenolate.
| Compound Name | 2-[(Z)-2-carboxy-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-4-chlorophenolate |
|---|---|
| PubChem CID | 54715499 |
| Molecular Formula | C13H11ClN3O3S- |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 2-[(Z)-2-carboxy-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-4-chlorophenolate |
| SMILES | CCc1nc(S/C(=C\c2cc(Cl)ccc2[O-])C(=O)O)n[nH]1 |
| InChI | InChI=1S/C13H12ClN3O3S/c1-2-11-15-13(17-16-11)21-10(12(19)20)6-7-5-8(14)3-4-9(7)18/h3-6,18H,2H2,1H3,(H,19,20)(H,15,16,17)/p-1/b10-6- |
| InChIKey | WYISAUDHTGEKCX-POHAHGRESA-M |
| XLogP | 2.31 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|