C17H15N5O2S — CID 124662145
(Z)-3-[1-(cyanomethyl)indol-3-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 124662145) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is (Z)-3-[1-(cyanomethyl)indol-3-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[1-(cyanomethyl)indol-3-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 124662145 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (Z)-3-[1-(cyanomethyl)indol-3-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | CCc1nc(S/C(=C\c2cn(CC#N)c3ccccc23)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C17H15N5O2S/c1-2-15-19-17(21-20-15)25-14(16(23)24)9-11-10-22(8-7-18)13-6-4-3-5-12(11)13/h3-6,9-10H,2,8H2,1H3,(H,23,24)(H,19,20,21)/b14-9- |
| InChIKey | SXMZEINHVSFACU-ZROIWOOFSA-N |
| XLogP | 3.06 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|