C22H18N4O — CID 126251981
(Z)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126251981) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126251981 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (Z)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1cn(CC#N)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O/c1-16(17-7-3-2-4-8-17)25-22(27)18(14-24)13-19-15-26(12-11-23)21-10-6-5-9-20(19)21/h2-10,13,15-16H,12H2,1H3,(H,25,27)/b18-13-/t16-/m1/s1 |
| InChIKey | ZGHRTHFBLCJQGA-OKSBFYSISA-N |
| XLogP | 3.95 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|