C27H22ClN3O — CID 126235881
(Z)-3-[1-[(2-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126235881) has the molecular formula C27H22ClN3O and a molecular weight of 439.95 g/mol. Its IUPAC name is (Z)-3-[1-[(2-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[1-[(2-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126235881 |
| Molecular Formula | C27H22ClN3O |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (Z)-3-[1-[(2-chlorophenyl)methyl]indol-3-yl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1cn(Cc2ccccc2Cl)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H22ClN3O/c1-19(20-9-3-2-4-10-20)30-27(32)22(16-29)15-23-18-31(26-14-8-6-12-24(23)26)17-21-11-5-7-13-25(21)28/h2-15,18-19H,17H2,1H3,(H,30,32)/b22-15-/t19-/m1/s1 |
| InChIKey | SWKKZJFKAQWYRM-MLPWYGTASA-N |
| XLogP | 6.13 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|