C29H21ClN4OS — CID 3790731
3-(1-benzylindol-3-yl)-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyanoprop-2-enamide (PubChem CID 3790731) has the molecular formula C29H21ClN4OS and a molecular weight of 509.03 g/mol. Its IUPAC name is 3-(1-benzylindol-3-yl)-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | 3-(1-benzylindol-3-yl)-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 3790731 |
| Molecular Formula | C29H21ClN4OS |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 3-(1-benzylindol-3-yl)-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1cn(Cc2ccccc2)c2ccccc12)C(=O)Nc1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C29H21ClN4OS/c30-26-12-6-4-10-21(26)15-24-17-32-29(36-24)33-28(35)22(16-31)14-23-19-34(18-20-8-2-1-3-9-20)27-13-7-5-11-25(23)27/h1-14,17,19H,15,18H2,(H,32,33,35) |
| InChIKey | FAOLKFNWOXSIFS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|