C20H13BrClN3OS — CID 7897820
(E)-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 7897820) has the molecular formula C20H13BrClN3OS and a molecular weight of 458.77 g/mol. Its IUPAC name is (E)-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 7897820 |
| Molecular Formula | C20H13BrClN3OS |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 456.97 |
| IUPAC Name | (E)-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1Cl)C(=O)Nc1ncc(Cc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C20H13BrClN3OS/c21-16-7-5-13(6-8-16)9-17-12-24-20(27-17)25-19(26)15(11-23)10-14-3-1-2-4-18(14)22/h1-8,10,12H,9H2,(H,24,25,26)/b15-10+ |
| InChIKey | PYCBKRBIISYLLU-XNTDXEJSSA-N |
| XLogP | 5.70 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|