C21H17ClN4O2S — CID 126195543
(Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 126195543) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is (Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126195543 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (Z)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | Cc1nc(S/C(=C\c2cn(Cc3ccc(Cl)cc3)c3ccccc23)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C21H17ClN4O2S/c1-13-23-21(25-24-13)29-19(20(27)28)10-15-12-26(18-5-3-2-4-17(15)18)11-14-6-8-16(22)9-7-14/h2-10,12H,11H2,1H3,(H,27,28)(H,23,24,25)/b19-10- |
| InChIKey | PBKWDRBBFOOVPC-GRSHGNNSSA-N |
| XLogP | 4.99 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|