C21H16FNO4 — CID 73334597
(2Z,5E)-6-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid (PubChem CID 73334597) has the molecular formula C21H16FNO4 and a molecular weight of 365.36 g/mol. Its IUPAC name is (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid.
| Compound Name | (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 73334597 |
| Molecular Formula | C21H16FNO4 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
| SMILES | O=C(/C=C(\O)C(=O)O)/C=C/c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H16FNO4/c22-16-8-5-14(6-9-16)12-23-13-15(18-3-1-2-4-19(18)23)7-10-17(24)11-20(25)21(26)27/h1-11,13,25H,12H2,(H,26,27)/b10-7+,20-11- |
| InChIKey | HEOPIVCQBXGWFP-VTGAJVDQSA-N |
| XLogP | 3.94 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|