C18H16FN3O2 — CID 5420937
methyl N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]carbamate (PubChem CID 5420937) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is methyl N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 5420937 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | methyl N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]carbamate |
| SMILES | COC(=O)N/N=C\c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C18H16FN3O2/c1-24-18(23)21-20-10-14-12-22(17-5-3-2-4-16(14)17)11-13-6-8-15(19)9-7-13/h2-10,12H,11H2,1H3,(H,21,23)/b20-10- |
| InChIKey | ODPLGFLEROIOKA-JMIUGGIZSA-N |
| XLogP | 3.52 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|