C17H16FN5S — CID 86579605
1-amino-3-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]thiourea (PubChem CID 86579605) has the molecular formula C17H16FN5S and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-amino-3-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]thiourea.
| Compound Name | 1-amino-3-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 86579605 |
| Molecular Formula | C17H16FN5S |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-amino-3-[(E)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]thiourea |
| SMILES | NNC(=S)N/N=C/c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C17H16FN5S/c18-14-7-5-12(6-8-14)10-23-11-13(9-20-22-17(24)21-19)15-3-1-2-4-16(15)23/h1-9,11H,10,19H2,(H2,21,22,24)/b20-9+ |
| InChIKey | TZZWFGQGMYIKPV-AWQFTUOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|