C24H16F2N4O — CID 5452926
4-cyano-2-fluoro-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 5452926) has the molecular formula C24H16F2N4O and a molecular weight of 414.42 g/mol. Its IUPAC name is 4-cyano-2-fluoro-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-cyano-2-fluoro-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 5452926 |
| Molecular Formula | C24H16F2N4O |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-cyano-2-fluoro-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | N#Cc1ccc(C(=O)N/N=C\c2cn(Cc3ccc(F)cc3)c3ccccc23)c(F)c1 |
| InChI | InChI=1S/C24H16F2N4O/c25-19-8-5-16(6-9-19)14-30-15-18(20-3-1-2-4-23(20)30)13-28-29-24(31)21-10-7-17(12-27)11-22(21)26/h1-11,13,15H,14H2,(H,29,31)/b28-13- |
| InChIKey | QMPOEYKQHFXEOM-QDTIIGTASA-N |
| XLogP | 4.60 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|