C21H19NO2 — CID 173414490
5-(1-benzylindol-3-yl)-2-methylpenta-2,4-dienoic acid (PubChem CID 173414490) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-(1-benzylindol-3-yl)-2-methylpenta-2,4-dienoic acid.
| Compound Name | 5-(1-benzylindol-3-yl)-2-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173414490 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-(1-benzylindol-3-yl)-2-methylpenta-2,4-dienoic acid |
| SMILES | CC(=CC=Cc1cn(Cc2ccccc2)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H19NO2/c1-16(21(23)24)8-7-11-18-15-22(14-17-9-3-2-4-10-17)20-13-6-5-12-19(18)20/h2-13,15H,14H2,1H3,(H,23,24) |
| InChIKey | JWSPLGCJTYIEHK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|