C28H27NO — CID 141206108
4-[(1E,6E)-7-(1-benzylindol-3-yl)hepta-1,6-dienyl]phenol (PubChem CID 141206108) has the molecular formula C28H27NO and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-[(1E,6E)-7-(1-benzylindol-3-yl)hepta-1,6-dienyl]phenol.
| Compound Name | 4-[(1E,6E)-7-(1-benzylindol-3-yl)hepta-1,6-dienyl]phenol |
|---|---|
| PubChem CID | 141206108 |
| Molecular Formula | C28H27NO |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-[(1E,6E)-7-(1-benzylindol-3-yl)hepta-1,6-dienyl]phenol |
| SMILES | Oc1ccc(/C=C/CCC/C=C/c2cn(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H27NO/c30-26-19-17-23(18-20-26)11-5-2-1-3-8-14-25-22-29(21-24-12-6-4-7-13-24)28-16-10-9-15-27(25)28/h4-20,22,30H,1-3,21H2/b11-5+,14-8+ |
| InChIKey | WQOSWQYPVOSOJU-XMGZOKRTSA-N |
| XLogP | 7.29 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|