C28H27NO2 — CID 67189930
(Z)-2-[2-(1-benzylindol-3-yl)ethyl]-5-phenylpent-4-enoic acid (PubChem CID 67189930) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (Z)-2-[2-(1-benzylindol-3-yl)ethyl]-5-phenylpent-4-enoic acid.
| Compound Name | (Z)-2-[2-(1-benzylindol-3-yl)ethyl]-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 67189930 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (Z)-2-[2-(1-benzylindol-3-yl)ethyl]-5-phenylpent-4-enoic acid |
| SMILES | O=C(O)C(C/C=C\c1ccccc1)CCc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H27NO2/c30-28(31)24(15-9-14-22-10-3-1-4-11-22)18-19-25-21-29(20-23-12-5-2-6-13-23)27-17-8-7-16-26(25)27/h1-14,16-17,21,24H,15,18-20H2,(H,30,31)/b14-9- |
| InChIKey | RJRAIYPNGGZYRJ-ZROIWOOFSA-N |
| XLogP | 6.43 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |