C19H19N — CID 174396068
1-benzyl-3-but-3-enylindole (PubChem CID 174396068) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-benzyl-3-but-3-enylindole.
| Compound Name | 1-benzyl-3-but-3-enylindole |
|---|---|
| PubChem CID | 174396068 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-benzyl-3-but-3-enylindole |
| SMILES | C=CCCc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H19N/c1-2-3-11-17-15-20(14-16-9-5-4-6-10-16)19-13-8-7-12-18(17)19/h2,4-10,12-13,15H,1,3,11,14H2 |
| InChIKey | BYQJBVQLEBRFRB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|