C28H30N4O4 — CID 135539100
ethyl 3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-2-diazo-3-oxopropanoate (PubChem CID 135539100) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-2-diazo-3-oxopropanoate.
| Compound Name | ethyl 3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-2-diazo-3-oxopropanoate |
|---|---|
| PubChem CID | 135539100 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-2-diazo-3-oxopropanoate |
| SMILES | C=CCCCC(=O)N(CCc1cn(Cc2ccccc2)c2ccccc12)C(=O)C(=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C28H30N4O4/c1-3-5-7-16-25(33)32(27(34)26(30-29)28(35)36-4-2)18-17-22-20-31(19-21-12-8-6-9-13-21)24-15-11-10-14-23(22)24/h3,6,8-15,20H,1,4-5,7,16-19H2,2H3 |
| InChIKey | VOQQFURCMCNIBP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 105.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|