C33H38N2O3Si — CID 42604402
benzyl N-[2-(1-benzylindol-3-yl)ethyl]-N-[3-(trimethylsilylmethyl)but-3-enoyl]carbamate (PubChem CID 42604402) has the molecular formula C33H38N2O3Si and a molecular weight of 538.76 g/mol. Its IUPAC name is benzyl N-[2-(1-benzylindol-3-yl)ethyl]-N-[3-(trimethylsilylmethyl)but-3-enoyl]carbamate.
| Compound Name | benzyl N-[2-(1-benzylindol-3-yl)ethyl]-N-[3-(trimethylsilylmethyl)but-3-enoyl]carbamate |
|---|---|
| PubChem CID | 42604402 |
| Molecular Formula | C33H38N2O3Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | benzyl N-[2-(1-benzylindol-3-yl)ethyl]-N-[3-(trimethylsilylmethyl)but-3-enoyl]carbamate |
| SMILES | C=C(CC(=O)N(CCc1cn(Cc2ccccc2)c2ccccc12)C(=O)OCc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C33H38N2O3Si/c1-26(25-39(2,3)4)21-32(36)35(33(37)38-24-28-15-9-6-10-16-28)20-19-29-23-34(22-27-13-7-5-8-14-27)31-18-12-11-17-30(29)31/h5-18,23H,1,19-22,24-25H2,2-4H3 |
| InChIKey | ZFTHXQVUMLZQGD-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|