C31H35N2O8P — CID 166467368
[[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-[(2-phenylacetyl)oxymethoxy]phosphoryl]oxymethyl 2-phenylacetate (PubChem CID 166467368) has the molecular formula C31H35N2O8P and a molecular weight of 594.60 g/mol. Its IUPAC name is [[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-[(2-phenylacetyl)oxymethoxy]phosphoryl]oxymethyl 2-phenylacetate.
| Compound Name | [[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-[(2-phenylacetyl)oxymethoxy]phosphoryl]oxymethyl 2-phenylacetate |
|---|---|
| PubChem CID | 166467368 |
| Molecular Formula | C31H35N2O8P |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | [[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-[(2-phenylacetyl)oxymethoxy]phosphoryl]oxymethyl 2-phenylacetate |
| SMILES | CN(C)CCc1cn(COP(=O)(OCOC(=O)Cc2ccccc2)OCOC(=O)Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C31H35N2O8P/c1-32(2)18-17-27-21-33(29-16-10-9-15-28(27)29)22-39-42(36,40-23-37-30(34)19-25-11-5-3-6-12-25)41-24-38-31(35)20-26-13-7-4-8-14-26/h3-16,21H,17-20,22-24H2,1-2H3 |
| InChIKey | RTZYSDVYGRFWBB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 105.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|