C18H29N2O5P — CID 168931152
[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl diethyl phosphate (PubChem CID 168931152) has the molecular formula C18H29N2O5P and a molecular weight of 384.41 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl diethyl phosphate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 168931152 |
| Molecular Formula | C18H29N2O5P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCn1cc(CCN(C)C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C18H29N2O5P/c1-6-23-26(21,24-7-2)25-14-20-13-15(10-11-19(3)4)17-9-8-16(22-5)12-18(17)20/h8-9,12-13H,6-7,10-11,14H2,1-5H3 |
| InChIKey | RDYZJBJWRAKSJA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|