C17H24N2O4 — CID 168931038
2-methoxyethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate (PubChem CID 168931038) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-methoxyethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate.
| Compound Name | 2-methoxyethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 168931038 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-methoxyethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate |
| SMILES | COCCOC(=O)n1cc(CCN(C)C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C17H24N2O4/c1-18(2)8-7-13-12-19(17(20)23-10-9-21-3)16-11-14(22-4)5-6-15(13)16/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | YBTNWXQEUFHHBN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|