C17H22N2O6 — CID 168930845
methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate (PubChem CID 168930845) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate.
| Compound Name | methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 168930845 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate |
| SMILES | COC(=O)OCOC(=O)n1cc(CCN(C)C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C17H22N2O6/c1-18(2)8-7-12-10-19(16(20)24-11-25-17(21)23-4)15-9-13(22-3)5-6-14(12)15/h5-6,9-10H,7-8,11H2,1-4H3 |
| InChIKey | BIGZUKQJMJTCRR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|