C21H28N2O6S — CID 168930954
thian-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate (PubChem CID 168930954) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is thian-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate.
| Compound Name | thian-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 168930954 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | thian-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxylate |
| SMILES | COc1ccc2c(CCN(C)C)cn(C(=O)OCOC(=O)OC3CCSCC3)c2c1 |
| InChI | InChI=1S/C21H28N2O6S/c1-22(2)9-6-15-13-23(19-12-17(26-3)4-5-18(15)19)20(24)27-14-28-21(25)29-16-7-10-30-11-8-16/h4-5,12-13,16H,6-11,14H2,1-3H3 |
| InChIKey | JASBHDPILDEIGW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|