C30H45N2O11P — CID 168930996
cyclohexyl [cyclohexyloxycarbonyloxymethoxy-[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methoxy]phosphoryl]oxymethyl carbonate (PubChem CID 168930996) has the molecular formula C30H45N2O11P and a molecular weight of 640.67 g/mol. Its IUPAC name is cyclohexyl [cyclohexyloxycarbonyloxymethoxy-[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methoxy]phosphoryl]oxymethyl carbonate.
| Compound Name | cyclohexyl [cyclohexyloxycarbonyloxymethoxy-[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methoxy]phosphoryl]oxymethyl carbonate |
|---|---|
| PubChem CID | 168930996 |
| Molecular Formula | C30H45N2O11P |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | cyclohexyl [cyclohexyloxycarbonyloxymethoxy-[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methoxy]phosphoryl]oxymethyl carbonate |
| SMILES | COc1ccc2c(CCN(C)C)cn(COP(=O)(OCOC(=O)OC3CCCCC3)OCOC(=O)OC3CCCCC3)c2c1 |
| InChI | InChI=1S/C30H45N2O11P/c1-31(2)17-16-23-19-32(28-18-26(36-3)14-15-27(23)28)20-39-44(35,40-21-37-29(33)42-24-10-6-4-7-11-24)41-22-38-30(34)43-25-12-8-5-9-13-25/h14-15,18-19,24-25H,4-13,16-17,20-22H2,1-3H3 |
| InChIKey | ABGIQZZHJSJEOW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 133.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|