C24H37N2O11P — CID 168837266
[[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 168837266) has the molecular formula C24H37N2O11P and a molecular weight of 560.54 g/mol. Its IUPAC name is [[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 168837266 |
| Molecular Formula | C24H37N2O11P |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | [[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C24H37N2O11P/c1-17(2)36-23(27)31-15-34-38(29,35-16-32-24(28)37-18(3)4)33-14-26-13-19(10-11-25(5)6)21-12-20(30-7)8-9-22(21)26/h8-9,12-13,17-18H,10-11,14-16H2,1-7H3 |
| InChIKey | KRDIPLVXACTFAR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 133.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|