C22H37N2O5P — CID 168931246
ditert-butyl [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl phosphate (PubChem CID 168931246) has the molecular formula C22H37N2O5P and a molecular weight of 440.52 g/mol. Its IUPAC name is ditert-butyl [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl phosphate.
| Compound Name | ditert-butyl [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 168931246 |
| Molecular Formula | C22H37N2O5P |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | ditert-butyl [3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]methyl phosphate |
| SMILES | COc1ccc2c(CCN(C)C)cn(COP(=O)(OC(C)(C)C)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C22H37N2O5P/c1-21(2,3)28-30(25,29-22(4,5)6)27-16-24-15-17(12-13-23(7)8)19-11-10-18(26-9)14-20(19)24/h10-11,14-15H,12-13,16H2,1-9H3 |
| InChIKey | DKOVZPLNYVYMEP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 62.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|