C27H34N4O3 — CID 166467355
bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone (PubChem CID 166467355) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone.
| Compound Name | bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone |
|---|---|
| PubChem CID | 166467355 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C(=O)n1cc(CCN(C)C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C27H34N4O3/c1-28(2)13-11-19-17-30(25-9-7-21(33-5)15-23(19)25)27(32)31-18-20(12-14-29(3)4)24-16-22(34-6)8-10-26(24)31/h7-10,15-18H,11-14H2,1-6H3 |
| InChIKey | PXDNVFWEXRBMOK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |