C33H48N2O2 — CID 166138368
(5Z,8Z,11Z,14Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]icosa-5,8,11,14-tetraen-1-one (PubChem CID 166138368) has the molecular formula C33H48N2O2 and a molecular weight of 504.76 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]icosa-5,8,11,14-tetraen-1-one.
| Compound Name | (5Z,8Z,11Z,14Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]icosa-5,8,11,14-tetraen-1-one |
|---|---|
| PubChem CID | 166138368 |
| Molecular Formula | C33H48N2O2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]icosa-5,8,11,14-tetraen-1-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)n1cc(CCN(C)C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C33H48N2O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-33(36)35-28-29(25-26-34(2)3)31-27-30(37-4)23-24-32(31)35/h9-10,12-13,15-16,18-19,23-24,27-28H,5-8,11,14,17,20-22,25-26H2,1-4H3/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | RTHSGTGMDLIUNG-SNPVRQPZSA-N |
| XLogP | 8.54 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|