C35H48N2O2 — CID 166138565
(4Z,7Z,10Z,13Z,16Z,19Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 166138565) has the molecular formula C35H48N2O2 and a molecular weight of 528.78 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 166138565 |
| Molecular Formula | C35H48N2O2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)n1cc(CCN(C)C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C35H48N2O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-35(38)37-30-31(27-28-36(2)3)33-29-32(39-4)25-26-34(33)37/h6-7,9-10,12-13,15-16,18-19,21-22,25-26,29-30H,5,8,11,14,17,20,23-24,27-28H2,1-4H3/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21- |
| InChIKey | JMYHCOSDEGFKOY-WSDBEMKQSA-N |
| XLogP | 8.87 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|