C18H25N3O4 — CID 166467618
[1-(dimethylamino)-2-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-2-oxoethyl] formate (PubChem CID 166467618) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is [1-(dimethylamino)-2-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-2-oxoethyl] formate.
| Compound Name | [1-(dimethylamino)-2-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-2-oxoethyl] formate |
|---|---|
| PubChem CID | 166467618 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [1-(dimethylamino)-2-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-2-oxoethyl] formate |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C(=O)C(OC=O)N(C)C |
| InChI | InChI=1S/C18H25N3O4/c1-19(2)9-8-13-11-21(17(23)18(20(3)4)25-12-22)16-7-6-14(24-5)10-15(13)16/h6-7,10-12,18H,8-9H2,1-5H3 |
| InChIKey | LQHRKUNGLQEVKJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|