C25H36N2O7 — CID 166467222
6-O-tert-butyl 1-O-[[3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbonyl]oxymethyl] hexanedioate (PubChem CID 166467222) has the molecular formula C25H36N2O7 and a molecular weight of 476.57 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-[[3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbonyl]oxymethyl] hexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-[[3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbonyl]oxymethyl] hexanedioate |
|---|---|
| PubChem CID | 166467222 |
| Molecular Formula | C25H36N2O7 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 6-O-tert-butyl 1-O-[[3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbonyl]oxymethyl] hexanedioate |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C(=O)OCOC(=O)CCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36N2O7/c1-25(2,3)34-23(29)10-8-7-9-22(28)32-17-33-24(30)27-16-18(13-14-26(4)5)20-15-19(31-6)11-12-21(20)27/h11-12,15-16H,7-10,13-14,17H2,1-6H3 |
| InChIKey | ZBGLANWGMMGFIH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|