C18H24N2O3 — CID 19970899
tert-butyl 3-[2-(dimethylamino)ethyl]-5-formylindole-1-carboxylate (PubChem CID 19970899) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 3-[2-(dimethylamino)ethyl]-5-formylindole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(dimethylamino)ethyl]-5-formylindole-1-carboxylate |
|---|---|
| PubChem CID | 19970899 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 3-[2-(dimethylamino)ethyl]-5-formylindole-1-carboxylate |
| SMILES | CN(C)CCc1cn(C(=O)OC(C)(C)C)c2ccc(C=O)cc12 |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)23-17(22)20-11-14(8-9-19(4)5)15-10-13(12-21)6-7-16(15)20/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | MJLQAYCMGCUPBY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|