C19H17NO4 — CID 10829746
tert-butyl 2,7-diformylcarbazole-9-carboxylate (PubChem CID 10829746) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl 2,7-diformylcarbazole-9-carboxylate.
| Compound Name | tert-butyl 2,7-diformylcarbazole-9-carboxylate |
|---|---|
| PubChem CID | 10829746 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | tert-butyl 2,7-diformylcarbazole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2cc(C=O)ccc2c2ccc(C=O)cc21 |
| InChI | InChI=1S/C19H17NO4/c1-19(2,3)24-18(23)20-16-8-12(10-21)4-6-14(16)15-7-5-13(11-22)9-17(15)20/h4-11H,1-3H3 |
| InChIKey | ALYVQSPAXFTERX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|