C18H25NO4 — CID 167311933
tert-butyl 4-(5-formyl-2-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 167311933) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 4-(5-formyl-2-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-formyl-2-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167311933 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl 4-(5-formyl-2-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccc(C=O)cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2,3)23-17(21)19-9-7-14(8-10-19)15-11-13(12-20)5-6-16(15)22-4/h5-6,11-12,14H,7-10H2,1-4H3 |
| InChIKey | NULIMAFHDRFIJT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|