C20H30N2O3 — CID 171103264
tert-butyl 4-[4-methoxy-3-[(E)-prop-1-enyl]anilino]piperidine-1-carboxylate (PubChem CID 171103264) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl 4-[4-methoxy-3-[(E)-prop-1-enyl]anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-methoxy-3-[(E)-prop-1-enyl]anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171103264 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl 4-[4-methoxy-3-[(E)-prop-1-enyl]anilino]piperidine-1-carboxylate |
| SMILES | C/C=C/c1cc(NC2CCN(C(=O)OC(C)(C)C)CC2)ccc1OC |
| InChI | InChI=1S/C20H30N2O3/c1-6-7-15-14-17(8-9-18(15)24-5)21-16-10-12-22(13-11-16)19(23)25-20(2,3)4/h6-9,14,16,21H,10-13H2,1-5H3/b7-6+ |
| InChIKey | CWELPWFVZCFKJN-VOTSOKGWSA-N |
| XLogP | 4.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|