C19H30N2O3 — CID 54491063
tert-butyl 4-(4-propan-2-yloxyanilino)piperidine-1-carboxylate (PubChem CID 54491063) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl 4-(4-propan-2-yloxyanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-propan-2-yloxyanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54491063 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl 4-(4-propan-2-yloxyanilino)piperidine-1-carboxylate |
| SMILES | CC(C)Oc1ccc(NC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-14(2)23-17-8-6-15(7-9-17)20-16-10-12-21(13-11-16)18(22)24-19(3,4)5/h6-9,14,16,20H,10-13H2,1-5H3 |
| InChIKey | XVTFEXKRRMFNMG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|