C24H31FN2O3 — CID 123845758
tert-butyl 4-[4-[2-(4-fluorophenoxy)ethyl]anilino]piperidine-1-carboxylate (PubChem CID 123845758) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(4-fluorophenoxy)ethyl]anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(4-fluorophenoxy)ethyl]anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123845758 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | tert-butyl 4-[4-[2-(4-fluorophenoxy)ethyl]anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(CCOc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H31FN2O3/c1-24(2,3)30-23(28)27-15-12-21(13-16-27)26-20-8-4-18(5-9-20)14-17-29-22-10-6-19(25)7-11-22/h4-11,21,26H,12-17H2,1-3H3 |
| InChIKey | WVNPTZMXCRYPNC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |