C17H25FN2O2 — CID 169123473
tert-butyl (3R,4R)-4-(4-fluoroanilino)-3-methylpiperidine-1-carboxylate (PubChem CID 169123473) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-(4-fluoroanilino)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-(4-fluoroanilino)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 169123473 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | tert-butyl (3R,4R)-4-(4-fluoroanilino)-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FN2O2/c1-12-11-20(16(21)22-17(2,3)4)10-9-15(12)19-14-7-5-13(18)6-8-14/h5-8,12,15,19H,9-11H2,1-4H3/t12-,15-/m1/s1 |
| InChIKey | WQMKGJQZFQVZTC-IUODEOHRSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |