C17H25FN2O3 — CID 169122818
tert-butyl (3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidine-1-carboxylate (PubChem CID 169122818) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 169122818 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | tert-butyl (3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1Nc1ccc(F)cc1O |
| InChI | InChI=1S/C17H25FN2O3/c1-11-10-20(16(22)23-17(2,3)4)8-7-13(11)19-14-6-5-12(18)9-15(14)21/h5-6,9,11,13,19,21H,7-8,10H2,1-4H3/t11-,13+/m0/s1 |
| InChIKey | XLSRCSIEIDLWIB-WCQYABFASA-N |
| XLogP | 3.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|