C18H26FN3O5 — CID 88874835
tert-butyl (3S,4S)-3-acetyloxy-4-[5-fluoro-2-(hydroxyamino)anilino]piperidine-1-carboxylate (PubChem CID 88874835) has the molecular formula C18H26FN3O5 and a molecular weight of 383.42 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-acetyloxy-4-[5-fluoro-2-(hydroxyamino)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-acetyloxy-4-[5-fluoro-2-(hydroxyamino)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88874835 |
| Molecular Formula | C18H26FN3O5 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | tert-butyl (3S,4S)-3-acetyloxy-4-[5-fluoro-2-(hydroxyamino)anilino]piperidine-1-carboxylate |
| SMILES | CC(=O)O[C@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1Nc1cc(F)ccc1NO |
| InChI | InChI=1S/C18H26FN3O5/c1-11(23)26-16-10-22(17(24)27-18(2,3)4)8-7-14(16)20-15-9-12(19)5-6-13(15)21-25/h5-6,9,14,16,20-21,25H,7-8,10H2,1-4H3/t14-,16-/m0/s1 |
| InChIKey | FESBCEXZFVYGMJ-HOCLYGCPSA-N |
| XLogP | 2.98 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|