C14H16FN3O6 — CID 67996243
(3S,4S)-3-acetyloxy-4-(5-fluoro-2-nitroanilino)piperidine-1-carboxylic acid (PubChem CID 67996243) has the molecular formula C14H16FN3O6 and a molecular weight of 341.30 g/mol. Its IUPAC name is (3S,4S)-3-acetyloxy-4-(5-fluoro-2-nitroanilino)piperidine-1-carboxylic acid.
| Compound Name | (3S,4S)-3-acetyloxy-4-(5-fluoro-2-nitroanilino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67996243 |
| Molecular Formula | C14H16FN3O6 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (3S,4S)-3-acetyloxy-4-(5-fluoro-2-nitroanilino)piperidine-1-carboxylic acid |
| SMILES | CC(=O)O[C@H]1CN(C(=O)O)CC[C@@H]1Nc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16FN3O6/c1-8(19)24-13-7-17(14(20)21)5-4-10(13)16-11-6-9(15)2-3-12(11)18(22)23/h2-3,6,10,13,16H,4-5,7H2,1H3,(H,20,21)/t10-,13-/m0/s1 |
| InChIKey | MZSKAQVQZFSLCE-GWCFXTLKSA-N |
| XLogP | 1.83 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|