C18H23N3O4 — CID 89075588
prop-1-en-2-yl 4-(5-cyclopropyl-2-nitroanilino)piperidine-1-carboxylate (PubChem CID 89075588) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is prop-1-en-2-yl 4-(5-cyclopropyl-2-nitroanilino)piperidine-1-carboxylate.
| Compound Name | prop-1-en-2-yl 4-(5-cyclopropyl-2-nitroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89075588 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | prop-1-en-2-yl 4-(5-cyclopropyl-2-nitroanilino)piperidine-1-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCC(Nc2cc(C3CC3)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H23N3O4/c1-12(2)25-18(22)20-9-7-15(8-10-20)19-16-11-14(13-3-4-13)5-6-17(16)21(23)24/h5-6,11,13,15,19H,1,3-4,7-10H2,2H3 |
| InChIKey | JHWFQDAMKYDLJW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|