About 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate
2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate (PubChem CID 71116561) has the molecular formula C15H20BrN3O4
and a molecular weight of 386.25 g/mol. Its IUPAC name is 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate |
| PubChem CID | 71116561 |
| Molecular Formula | C15H20BrN3O4 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(Nc2cc(Br)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H20BrN3O4/c1-10(2)9-23-15(20)18-6-5-12(8-18)17-13-7-11(16)3-4-14(13)19(21)22/h3-4,7,10,12,17H,5-6,8-9H2,1-2H3 |
| InChIKey | MZZUEVKPQAZMBX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate?
The IUPAC name of 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate (CID 71116561) is 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate is CC(C)COC(=O)N1CCC(Nc2cc(Br)ccc2[N+](=O)[O-])C1.
What is the InChIKey of 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate?
The InChIKey is MZZUEVKPQAZMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3O4/c1-10(2)9-23-15(20)18-6-5-12(8-18)17-13-7-11(16)3-4-14(13)19(21)22/h3-4,7,10,12,17H,5-6,8-9H2,1-2H3.
What are the key properties of 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate?
2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate has a molecular weight of 386.25 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-(5-bromo-2-nitroanilino)pyrrolidine-1-carboxylate is sourced from PubChem (CID 71116561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).