C17H27N3O2 — CID 69132792
2-methylpropyl 4-(2-amino-5-methylanilino)piperidine-1-carboxylate (PubChem CID 69132792) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-methylpropyl 4-(2-amino-5-methylanilino)piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(2-amino-5-methylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69132792 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-methylpropyl 4-(2-amino-5-methylanilino)piperidine-1-carboxylate |
| SMILES | Cc1ccc(N)c(NC2CCN(C(=O)OCC(C)C)CC2)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-12(2)11-22-17(21)20-8-6-14(7-9-20)19-16-10-13(3)4-5-15(16)18/h4-5,10,12,14,19H,6-9,11,18H2,1-3H3 |
| InChIKey | NZPDVVCLDBZLRP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|