C29H36N4O2 — CID 25192544
[(2S)-2-(dibenzylamino)propyl] 4-(2-aminoanilino)piperidine-1-carboxylate (PubChem CID 25192544) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is [(2S)-2-(dibenzylamino)propyl] 4-(2-aminoanilino)piperidine-1-carboxylate.
| Compound Name | [(2S)-2-(dibenzylamino)propyl] 4-(2-aminoanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25192544 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [(2S)-2-(dibenzylamino)propyl] 4-(2-aminoanilino)piperidine-1-carboxylate |
| SMILES | C[C@@H](COC(=O)N1CCC(Nc2ccccc2N)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H36N4O2/c1-23(33(20-24-10-4-2-5-11-24)21-25-12-6-3-7-13-25)22-35-29(34)32-18-16-26(17-19-32)31-28-15-9-8-14-27(28)30/h2-15,23,26,31H,16-22,30H2,1H3/t23-/m0/s1 |
| InChIKey | BASIXXKWODXZHH-QHCPKHFHSA-N |
| XLogP | 5.37 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|