C30H38N4O2 — CID 67177559
2-(dibenzylamino)propyl (4S)-4-(2-aminoanilino)azepane-1-carboxylate (PubChem CID 67177559) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-(dibenzylamino)propyl (4S)-4-(2-aminoanilino)azepane-1-carboxylate.
| Compound Name | 2-(dibenzylamino)propyl (4S)-4-(2-aminoanilino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 67177559 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 2-(dibenzylamino)propyl (4S)-4-(2-aminoanilino)azepane-1-carboxylate |
| SMILES | CC(COC(=O)N1CCC[C@H](Nc2ccccc2N)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H38N4O2/c1-24(34(21-25-11-4-2-5-12-25)22-26-13-6-3-7-14-26)23-36-30(35)33-19-10-15-27(18-20-33)32-29-17-9-8-16-28(29)31/h2-9,11-14,16-17,24,27,32H,10,15,18-23,31H2,1H3/t24?,27-/m0/s1 |
| InChIKey | CGGPXJHVJQBIIP-WKDCXCOVSA-N |
| XLogP | 5.76 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|